CymitQuimica logo

CAS 1242339-25-8

:

4,5-Dibromo-2-(trifluoromethyl)benzonitrile

Description:
4,5-Dibromo-2-(trifluoromethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and trifluoromethyl groups. The presence of the bromine atoms at the 4 and 5 positions contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The trifluoromethyl group, located at the 2 position, enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical chemistry. The nitrile functional group (-C≡N) adds to its polarity and can participate in nucleophilic reactions. This compound is typically used in research and development, particularly in the synthesis of other complex molecules. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the halogen substituents and the nitrile group, which can affect its behavior in different solvents and environments. Overall, 4,5-Dibromo-2-(trifluoromethyl)benzonitrile is a versatile compound with significant implications in organic synthesis and material science.
Formula:C8H2Br2F3N
InChI:InChI=1S/C8H2Br2F3N/c9-6-1-4(3-14)5(2-7(6)10)8(11,12)13/h1-2H
InChI key:InChIKey=COCONGCGJVRAOO-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(F)(F)F)C=C(Br)C(Br)=C1
Synonyms:
  • 4,5-Dibromo-2-(trifluoromethyl)benzonitrile
  • Benzonitrile, 4,5-dibromo-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.