
CAS 1242339-44-1
:1,1,1-Trifluoro-3-methyl-2-pentanamine
Description:
1,1,1-Trifluoro-3-methyl-2-pentanamine is an organic compound characterized by the presence of a trifluoromethyl group, a branched alkyl chain, and an amine functional group. The trifluoromethyl group contributes to the compound's unique properties, including increased lipophilicity and potential biological activity. The presence of the amine group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. This compound is likely to be a colorless to pale liquid or solid, depending on its specific structure and conditions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the trifluoromethyl group can enhance the stability and metabolic profile of the compound, making it of interest in medicinal chemistry. However, detailed safety and handling information should be consulted, as fluorinated compounds can exhibit unique toxicological profiles. Overall, 1,1,1-Trifluoro-3-methyl-2-pentanamine represents a class of compounds that combine fluorine chemistry with amine functionality, offering diverse applications in various fields.
Formula:C6H12F3N
InChI:InChI=1S/C6H12F3N/c1-3-4(2)5(10)6(7,8)9/h4-5H,3,10H2,1-2H3
InChI key:InChIKey=IIRLSLVVRQOEDF-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(CC)C)N
Synonyms:- 1,1,1-Trifluoro-3-methyl-2-pentylamine
- 1,1,1-Trifluoro-3-methyl-2-pentanamine
- 2-Pentanamine, 1,1,1-trifluoro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.