CAS 1242339-61-2

1H-Indazol-4-amine, 4,5,6,7-tetrahydro-6,6-dimethyl-1-(2-methylphenyl)-, hydrochloride (1:1)

Description:

1H-Indazol-4-amine, 4,5,6,7-tetrahydro-6,6-dimethyl-1-(2-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The presence of the amine functional group indicates potential basicity and reactivity, particularly in forming salts, as evidenced by its hydrochloride form. The tetrahydro configuration suggests that the compound has a saturated structure, which may influence its physical properties such as solubility and stability. The presence of dimethyl and methylphenyl substituents contributes to its steric and electronic properties, potentially affecting its biological activity and interactions. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug development. As with many organic compounds, its behavior in various environments, including solubility in different solvents and reactivity with other chemical species, would be essential for practical applications. Safety data and handling precautions should be considered due to the potential biological activity of the compound.

Formula: C₁₆H₂₁N₃·ClH

InChI: InChI=1S/C16H21N3.ClH/c1-11-6-4-5-7-14(11)19-15-9-16(2,3)8-13(17)12(15)10-18-19;/h4-7,10,13H,8-9,17H2,1-3H3;1H

InChI key: InChIKey=GINFOOVOHGEONY-UHFFFAOYSA-N

SMILES: NC1C2=C(N(N=C2)C3=C(C)C=CC=C3)CC(C)(C)C1.Cl

Synonyms:

• 1H-Indazol-4-amine, 4,5,6,7-tetrahydro-6,6-dimethyl-1-(2-methylphenyl)-, hydrochloride (1:1)