
CAS 1242339-62-3
:5-[2-(Acetylamino)phenyl]-2-pyridinecarboxylic acid
Description:
5-[2-(Acetylamino)phenyl]-2-pyridinecarboxylic acid, identified by its CAS number 1242339-62-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring and an acetylamino group attached to a phenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of carboxylic acid and amine functional groups. Its molecular structure suggests it may possess biological activity, potentially serving as a pharmaceutical intermediate or a lead compound in drug development. The presence of the pyridine ring may contribute to its electronic properties, influencing reactivity and interaction with biological targets. Additionally, the compound's stability, melting point, and solubility characteristics would depend on environmental conditions and the specific formulation. Overall, this compound's unique functional groups and structural features make it of interest in both synthetic chemistry and medicinal applications.
Formula:C14H12N2O3
InChI:InChI=1S/C14H12N2O3/c1-9(17)16-12-5-3-2-4-11(12)10-6-7-13(14(18)19)15-8-10/h2-8H,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=MEFRGTVPJKCXDK-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(C=CC=C1)C=2C=CC(C(O)=O)=NC2
Synonyms:- 5-[2-(Acetylamino)phenyl]-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 5-[2-(acetylamino)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.