
CAS 1242339-67-8
:2-Chloro-4,6-difluorobenzoic acid
Description:
2-Chloro-4,6-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure substituted with chlorine and fluorine atoms. Specifically, it features a chlorine atom at the second position and two fluorine atoms at the fourth and sixth positions of the benzene ring. This compound is typically a white to off-white solid and is known for its moderate solubility in organic solvents and limited solubility in water. The presence of electronegative halogen substituents influences its chemical reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. It may also exhibit unique properties such as altered acidity compared to unsubstituted benzoic acid due to the electron-withdrawing effects of the halogens. Additionally, 2-Chloro-4,6-difluorobenzoic acid can be utilized in the synthesis of pharmaceuticals and agrochemicals, highlighting its significance in organic synthesis and industrial applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C7H3ClF2O2
InChI:InChI=1S/C7H3ClF2O2/c8-4-1-3(9)2-5(10)6(4)7(11)12/h1-2H,(H,11,12)
InChI key:SHCCCLQAWAYTLM-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)C(=O)O)Cl)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4,6-difluorobenzoic acid
CAS:2-Chloro-4,6-difluorobenzoic acidFormula:C7H3ClF2O2Purity:95%Color and Shape:SolidMolecular weight:192.547322-Chloro-4,6-difluorobenzoic acid
CAS:Formula:C7H3ClF2O2Purity:98%Color and Shape:SolidMolecular weight:192.54732-Chloro-4,6-difluorobenzoic acid
CAS:2-Chloro-4,6-difluorobenzoic acidFormula:C7H3ClF2O2Purity:97%Molecular weight:192.552-Chloro-4,6-difluorobenzoic acid
CAS:2-Chloro-4,6-difluorobenzoic acid is the product of a reaction between 2-chloro-4,6-difluoroaniline and 4,6-dichlorobenzonitrile. It is used as a building block in the synthesis of pharmaceuticals and other specialty chemicals. 2-Chloro-4,6-difluorobenzoic acid is also used as a reagent in organic synthesis reactions. This chemical is soluble in water and has a boiling point of 190°C. 2CDFBA is found in CAS No. 1242339-67-8 and can be stored at room temperature.Formula:C7H3ClF2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:192.55 g/mol2-Chloro-4,6-difluorobenzoic acid
CAS:Formula:C7H3ClF2O2Purity:95%Color and Shape:SolidMolecular weight:192.55




