CAS 1242339-68-9

5-[2-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid

Description:

5-[2-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid, identified by its CAS number 1242339-68-9, is an organic compound characterized by its complex structure that includes both pyridine and aromatic functionalities. This compound features a pyridine ring substituted at the 2-position with a carboxylic acid group and a phenyl group that is further substituted with a methoxycarbonyl group at the 2-position. The presence of the methoxycarbonyl group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The carboxylic acid functionality provides acidic properties, allowing for potential applications in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.

Formula: C₁₄H₁₁NO₄

InChI: InChI=1S/C14H11NO4/c1-19-14(18)11-5-3-2-4-10(11)9-6-7-12(13(16)17)15-8-9/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=AONIUPYTDLUZBD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C=CC=C1)C=2C=CC(C(O)=O)=NC2

Synonyms:

• 5-[2-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-[2-(methoxycarbonyl)phenyl]-