
CAS 1242339-72-5
:1-Chloro-2-fluoro-5-iodo-4-methylbenzene
Description:
1-Chloro-2-fluoro-5-iodo-4-methylbenzene, also known by its CAS number 1242339-72-5, is an aromatic halogenated compound characterized by the presence of multiple halogen substituents and a methyl group on a benzene ring. The structure features a chlorine atom, a fluorine atom, and an iodine atom attached to the benzene ring, along with a methyl group at the para position relative to the iodine. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased reactivity due to the presence of electronegative halogens, which can influence its chemical behavior in reactions like nucleophilic substitution or electrophilic aromatic substitution. The presence of these halogens can also affect the compound's physical properties, such as boiling and melting points, solubility, and polarity. Additionally, the specific arrangement of substituents can lead to unique steric and electronic effects, making it of interest in various fields, including medicinal chemistry and materials science. Safety and handling precautions should be observed due to the potential toxicity of halogenated compounds.
Formula:C7H5ClFI
InChI:InChI=1S/C7H5ClFI/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3
InChI key:InChIKey=BJZGSCBCOSXQCV-UHFFFAOYSA-N
SMILES:CC1=C(I)C=C(Cl)C(F)=C1
Synonyms:- 1-Chloro-2-fluoro-5-iodo-4-methylbenzene
- Benzene, 1-chloro-2-fluoro-5-iodo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.