CAS 1242339-73-6

4-Chloro-3-(chlorosulfonyl)-5-fluorobenzoic acid

Description:

4-Chloro-3-(chlorosulfonyl)-5-fluorobenzoic acid is a chemical compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both chlorine and fluorine atoms, as well as a chlorosulfonyl group. The presence of the chlorosulfonyl group indicates that it has strong electrophilic properties, making it reactive in various chemical reactions, particularly in nucleophilic substitutions. The chlorine and fluorine substituents contribute to the compound's overall polarity and can influence its solubility in different solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique functional groups suggest potential applications in the development of biologically active molecules. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactive nature and the presence of halogenated groups. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.

Formula: C₇H₃Cl₂FO₄S

InChI: InChI=1S/C7H3Cl2FO4S/c8-6-4(10)1-3(7(11)12)2-5(6)15(9,13)14/h1-2H,(H,11,12)

InChI key: InChIKey=JEXDRGZPMXSFGP-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC(C(O)=O)=CC(F)=C1Cl

Synonyms:

• 4-Chloro-3-(chlorosulfonyl)-5-fluorobenzoic acid
• Benzoic acid, 4-chloro-3-(chlorosulfonyl)-5-fluoro-