CAS 1242339-80-5

2-Chloro-4,6-difluorobenzenesulfonyl chloride

Description:

2-Chloro-4,6-difluorobenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a benzene ring substituted with two fluorine atoms and a chlorine atom, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions. It is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. Additionally, it may be sensitive to moisture, which can lead to hydrolysis of the sulfonyl chloride group. As with many halogenated compounds, it is important to consider its environmental impact and potential for bioaccumulation.

Formula: C₆H₂Cl₂F₂O₂S

InChI: InChI=1S/C6H2Cl2F2O2S/c7-4-1-3(9)2-5(10)6(4)13(8,11)12/h1-2H

InChI key: InChIKey=LQNJFBCFVPOKJD-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(Cl)C=C(F)C=C1F

Synonyms:

• Benzenesulfonyl chloride, 2-chloro-4,6-difluoro-
• 2-Chloro-4,6-difluorobenzenesulfonyl chloride