CAS 1242339-97-4

5-[4-(Methylsulfonyl)phenyl]-2-pyridinecarboxylic acid

Description:

5-[4-(Methylsulfonyl)phenyl]-2-pyridinecarboxylic acid, identified by its CAS number 1242339-97-4, is an organic compound characterized by its complex molecular structure, which includes a pyridine ring and a phenyl group substituted with a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both acidic and polar functional groups. It may display acidic behavior due to the carboxylic acid moiety, which can donate protons in solution. The methylsulfonyl group can enhance the compound's solubility and reactivity, making it potentially useful in various chemical reactions or as a pharmaceutical intermediate. Additionally, the presence of both aromatic and heterocyclic components suggests that it may possess interesting electronic properties, which could be relevant in medicinal chemistry. Overall, this compound's unique structure and functional groups contribute to its potential applications in drug development and other chemical syntheses.

Formula: C₁₃H₁₁NO₄S

InChI: InChI=1S/C13H11NO4S/c1-19(17,18)11-5-2-9(3-6-11)10-4-7-12(13(15)16)14-8-10/h2-8H,1H3,(H,15,16)

InChI key: InChIKey=RPNCHWKAJVJATR-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC=C(C=C1)C=2C=CC(C(O)=O)=NC2

Synonyms:

• 5-[4-(Methylsulfonyl)phenyl]-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-[4-(methylsulfonyl)phenyl]-