CAS 124236-30-2

2-Butenamide, N-ethyl-N-(2-methylphenyl)-, (Z)-

Description:

2-Butenamide, N-ethyl-N-(2-methylphenyl)-, (Z)- is an organic compound characterized by its amide functional group and a specific geometric configuration indicated by the (Z) designation, which refers to the arrangement of substituents around the double bond. This compound features a butenamide backbone, with an ethyl group and a 2-methylphenyl group attached to the nitrogen atom, contributing to its unique properties. The presence of the double bond in the butenamide structure imparts reactivity, making it potentially useful in various chemical reactions, such as polymerization or as an intermediate in organic synthesis. The aromatic 2-methylphenyl group enhances the compound's stability and may influence its solubility and interaction with biological systems. Additionally, the compound's specific stereochemistry can affect its biological activity and reactivity. Overall, 2-Butenamide, N-ethyl-N-(2-methylphenyl)-, (Z)- is a compound of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₃H₁₇NO

InChI: InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4-

InChI key: InChIKey=DNTGGZPQPQTDQF-YWEYNIOJSA-N

SMILES: N(C(/C=C\C)=O)(CC)C1=C(C)C=CC=C1

Synonyms:

• 2-Butenamide, N-ethyl-N-(2-methylphenyl)-, (Z)-
• cis-Crotamiton

(Z)-Crotamiton

CAS: 124236-30-2

Formula: C₁₃H₁₇NO

Molecular weight: 203.29

Ref: 4Z-C-308003