CAS 124236-37-9

5-TRIFLUOROMETHYL-PYRIDINE-2-CARBOXYLICACIDMETHYLESTER

Description:

5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 5-position of the pyridine ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The carboxylic acid methyl ester functional group indicates that the compound can undergo hydrolysis to yield the corresponding carboxylic acid, which may exhibit different solubility and reactivity profiles. This compound is often utilized in organic synthesis and medicinal chemistry due to its unique structural features, which can serve as a building block for more complex molecules. Additionally, the trifluoromethyl group is known to impart desirable properties such as increased metabolic stability and altered pharmacokinetics in drug development. Overall, 5-trifluoromethyl-pyridine-2-carboxylic acid methyl ester is a versatile compound with applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₆F₃NO₂

InChI: InChI=1/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3

SMILES: COC(=O)c1ccc(cn1)C(F)(F)F

Synonyms:

• Methyl 5-(trifluoromethyl)picolinate
• Methyl 5-(trifluoromethyl)pyridine-2-carboxylate
• 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,methyl ester

2-Pyridinecarboxylic acid, 5-(trifluoromethyl)-, methyl ester

CAS: 124236-37-9

Formula: C₈H₆F₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.1339

Ref: IN-DA000LRC

Methyl 5-(trifluoromethyl)pyridine-2-carboxylate

CAS: 124236-37-9

Methyl 5-(trifluoromethyl)pyridine-2-carboxylate

Purity: 95%

Molecular weight: 205.13g/mol

Ref: 54-PC3708

Methyl 5-(trifluoromethyl)pyridine-2-carboxylate

CAS: 124236-37-9

Formula: C₈H₆F₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.136

Ref: 10-F045317