
CAS 124236-41-5
:(2-Cyclopropylphenyl)hydrazine
Description:
(2-Cyclopropylphenyl)hydrazine, with the CAS number 124236-41-5, is an organic compound characterized by the presence of a hydrazine functional group attached to a cyclopropyl-substituted phenyl ring. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The cyclopropyl group introduces unique steric and electronic effects, potentially influencing the compound's reactivity and stability. (2-Cyclopropylphenyl)hydrazine may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex organic molecules. As with many hydrazine derivatives, it is essential to handle this compound with care, as hydrazines can be toxic and may pose health risks. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c10-11-9-4-2-1-3-8(9)7-5-6-7/h1-4,7,11H,5-6,10H2
InChI key:InChIKey=XVGHDSWRWBFBAX-UHFFFAOYSA-N
SMILES:N(N)C1=C(C=CC=C1)C2CC2
Synonyms:- 2-Cyclopropylphenylhydrazin
- (2-Cyclopropylphenyl)hydrazine
- Hydrazine, (2-cyclopropylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.