CAS 124252-41-1
:4-(TRIBUTYLSTANNYL)PYRIDINE
Description:
4-(Tributylstannyl)pyridine is an organotin compound characterized by the presence of a pyridine ring substituted with a tributylstannyl group. This compound typically exhibits a pale yellow to colorless appearance and is soluble in organic solvents due to its hydrophobic tributyl groups. The tributylstannyl moiety contributes to its reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis and as a potential precursor in materials science. The presence of the pyridine nitrogen can also facilitate coordination with metal ions, enhancing its utility in catalysis and coordination chemistry. Additionally, this compound may exhibit unique properties such as thermal stability and specific electronic characteristics due to the conjugated system of the pyridine ring. However, it is important to handle organotin compounds with care due to potential toxicity and environmental concerns associated with tin-based substances. Overall, 4-(tributylstannyl)pyridine is a versatile compound with applications in synthetic chemistry and materials development.
Formula:C17H31NSn
InChI:InChI=1/C5H4N.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h2-5H;3*1,3-4H2,2H3;/rC17H31NSn/c1-4-7-14-19(15-8-5-2,16-9-6-3)17-10-12-18-13-11-17/h10-13H,4-9,14-16H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1ccncc1
Synonyms:- Pyridine, 4-(tributylstannyl)-
- 4-(Tributylstannanyl)Pyridine
- 4-(Tributylstannyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Tri-n-butylstannyl)pyridine, 96%
CAS:4-(Tri-n-butylstannyl)pyridine is used as organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item coFormula:C17H31NSnPurity:96%Molecular weight:368.15Pyridine, 4-(tributylstannyl)-
CAS:Formula:C17H31NSnPurity:98%Color and Shape:LiquidMolecular weight:368.13574-(Tributylstannyl)pyridine
CAS:4-(Tributylstannyl)pyridine is an organotin compound used in organic synthesis and biochemical experiments.Formula:C17H31NSnPurity:98.00%Color and Shape:SolidMolecular weight:368.154-(Tributylstannyl)pyridine
CAS:4-(Tributylstannyl)pyridineFormula:C17H31NSnPurity:96%Color and Shape: brown liquidMolecular weight:368.14g/mol4-(Tributylstannyl)pyridine
CAS:Controlled ProductVersatile small molecule scaffold
Formula:C17H31NSnPurity:Min. 95%Molecular weight:368.15 g/mol





