CAS 124269-04-1
:4-azaspiro[2.5]octane
Description:
4-Azaspiro[2.5]octane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom integrated into a bicyclic framework. This compound features a spiro connection between two rings, contributing to its distinct three-dimensional shape. The presence of the nitrogen atom introduces basicity and potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. 4-Azaspiro[2.5]octane is of interest in medicinal chemistry and drug design due to its structural properties, which may enhance biological activity or selectivity in pharmacological applications. Its relatively rigid structure can affect the conformational flexibility, which is crucial for binding interactions with biological targets. Additionally, the compound's stability and solubility characteristics can vary based on the functional groups attached to the spiro framework. Overall, 4-azaspiro[2.5]octane represents a fascinating area of study within organic and medicinal chemistry, with potential implications in the development of new therapeutic agents.
Formula:C7H13N
InChI:InChI=1/C7H13N/c1-2-6-8-7(3-1)4-5-7/h8H,1-6H2
SMILES:C1CCNC2(C1)CC2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
