CAS 1242733-92-1

Borate(1-), trifluoro-5-isoquinolinyl-, potassium (1:1), (T-4)-

Description:

Borate(1-), trifluoro-5-isoquinolinyl-, potassium (1:1), commonly referred to by its CAS number 1242733-92-1, is a chemical compound that features a borate anion coordinated with a trifluoro-5-isoquinolinyl group and potassium cation. This compound is characterized by its unique structural components, which include a boron atom bonded to an oxygen atom, forming the borate ion, and a complex aromatic system derived from isoquinoline, which contributes to its potential biological activity and chemical reactivity. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its interaction with biological targets. As a potassium salt, it exhibits solubility in polar solvents, which is typical for many ionic compounds. The compound's properties, such as stability, reactivity, and potential applications, can be influenced by the specific arrangement of its molecular components and the presence of the trifluoromethyl group, making it of interest in various fields, including medicinal chemistry and materials science.

Formula: C₉H₆BF₃N·K

InChI: InChI=1S/C9H6BF3N.K/c11-10(12,13)9-3-1-2-7-6-14-5-4-8(7)9;/h1-6H;/q-1;+1

InChI key: InChIKey=STDAXMQHDJGDGH-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[C-]=1C2=C(C=CC1)C=NC=C2.[K+]

Synonyms:

• Borate(1-), trifluoro-5-isoquinolinyl-, potassium (1:1), (T-4)-