CAS 124276-45-5

Cyclopropanecarbonitrile, 1-(2-chloro-6-fluorophenyl)-

Description:

Cyclopropanecarbonitrile, 1-(2-chloro-6-fluorophenyl)-, with the CAS number 124276-45-5, is an organic compound characterized by its unique structure that includes a cyclopropane ring and a carbonitrile functional group. The presence of a 2-chloro-6-fluorophenyl substituent contributes to its chemical properties, potentially influencing its reactivity and interactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to exhibit moderate polarity due to the presence of the nitrile group, which can engage in hydrogen bonding and dipole-dipole interactions. The chlorofluorophenyl moiety may impart additional characteristics such as increased lipophilicity and potential biological activity. Cyclopropanecarbonitrile derivatives are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential applications in synthesis and as intermediates in chemical reactions. Safety data should be consulted for handling and storage, as compounds with halogenated substituents can exhibit toxicity or environmental concerns.

Formula: C₁₀H₇ClFN

InChI: InChI=1S/C10H7ClFN/c11-7-2-1-3-8(12)9(7)10(6-13)4-5-10/h1-3H,4-5H2

InChI key: InChIKey=DMOHTRXTNDOCKQ-UHFFFAOYSA-N

SMILES: C(#N)C1(C2=C(Cl)C=CC=C2F)CC1

Synonyms:

• Cyclopropanecarbonitrile, 1-(2-chloro-6-fluorophenyl)-
• 1-(2-Chloro-6-fluorophenyl)cyclopropanecarbonitrile

1-(2-chloro-6-fluorophenyl)cyclopropane-1-carbonitrile

CAS: 124276-45-5

Formula: C₁₀H₇ClFN

Molecular weight: 195.6207

Ref: IN-DA000LSJ