
CAS 124276-47-7
:Benzonitrile, 2-(1-cyanocyclopropyl)-
Description:
Benzonitrile, 2-(1-cyanocyclopropyl)-, also known by its CAS number 124276-47-7, is an organic compound characterized by the presence of a benzonitrile moiety and a cyclopropyl group with a cyano substituent. This compound features a benzene ring attached to a nitrile group (–C≡N) and a cyclopropyl group that is further substituted with a cyano group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. The presence of the nitrile functional group imparts polar characteristics, making it soluble in polar solvents while being relatively insoluble in non-polar solvents. Benzonitrile derivatives are often utilized in organic synthesis and can serve as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting reactivity due to the strained cyclopropyl ring, which can influence its chemical behavior in various reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c12-7-9-3-1-2-4-10(9)11(8-13)5-6-11/h1-4H,5-6H2
InChI key:InChIKey=OPTAYCRJRKMNHW-UHFFFAOYSA-N
SMILES:C(#N)C1(CC1)C2=C(C#N)C=CC=C2
Synonyms:- 2-(1-Cyanocyclopropyl)benzonitrile
- Benzonitrile, 2-(1-cyanocyclopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.