CAS 124276-57-9: 1-(3,4-dichlorophenyl)cyclopropanecarbonitrile
Description:1-(3,4-Dichlorophenyl)cyclopropanecarbonitrile, with the CAS number 124276-57-9, is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a cyano group attached to a dichlorophenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the cyano group (-C≡N) suggests that it may participate in nucleophilic reactions, while the dichlorophenyl group can influence its electronic properties and solubility. The dichlorination introduces significant electronegativity, which can affect the compound's interactions with biological systems and its overall chemical behavior. Additionally, the cyclopropane ring adds strain, which may enhance reactivity under certain conditions. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility in synthetic applications. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C10H7Cl2N
InChI:InChI=1S/C10H7Cl2N/c11-8-2-1-7(5-9(8)12)10(6-13)3-4-10/h1-2,5H,3-4H2
InChI key:InChIKey=SJDZLTHRJVBKJM-UHFFFAOYSA-N
SMILES:N#CC1(C2=CC=C(Cl)C(Cl)=C2)CC1
- Synonyms:
- 1-(3,4-Dichlorophenyl)cyclopropane-1-carbonitrile
- Cyclopropanecarbonitrile, 1-(3,4-Dichlorophenyl)-

Cyclopropanecarbonitrile, 1-(3,4-dichlorophenyl)-
Ref: IN-DA000LSH
1g | 47.00 € | ||
5g | 144.00 € | ||
250mg | 24.00 € |

1-(3,4-Dichlorophenyl)cyclopropanecarbonitrile
Ref: 54-OR90101
5g | 120.00 € |

1-(3,4-Dichlorophenyl)cyclopropanecarbonitrile
Ref: 10-F609218
1g | 31.00 € | ||
5g | 108.00 € |

1-(3,4-dichlorophenyl)cyclopropane-1-carbonitrile
Ref: 3D-ZEA27657
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
500mg | Discontinued | Request information |