CAS 124276-91-1

Benzoic acid, 3-(1-carboxycyclopropyl)-

Description:

Benzoic acid, 3-(1-carboxycyclopropyl)-, is an organic compound characterized by its carboxylic acid functional group and a cyclopropyl ring. This compound features a benzoic acid moiety, which contributes to its acidity and potential for hydrogen bonding. The presence of the cyclopropyl group introduces unique steric and electronic effects, influencing its reactivity and interaction with other molecules. Typically, compounds like this can exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic ring may enhance hydrophobic interactions. The compound may also participate in various chemical reactions, such as esterification or amidation, due to its functional groups. Its structural characteristics suggest potential applications in pharmaceuticals or as intermediates in organic synthesis. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization. Overall, the unique combination of functional groups in this compound makes it an interesting subject for further study in organic chemistry.

Formula: C₁₁H₁₀O₄

InChI: InChI=1S/C11H10O4/c12-9(13)7-2-1-3-8(6-7)11(4-5-11)10(14)15/h1-3,6H,4-5H2,(H,12,13)(H,14,15)

InChI key: InChIKey=HRTUUBPEGYUROJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 3-(1-Carboxycyclopropyl)benzoic acid
• Benzoic acid, 3-(1-carboxycyclopropyl)-