CAS 124285-37-6

2(3H)-Thiazolone,4,5-dimethyl-,hydrazone(9CI)

Description:

2(3H)-Thiazolone, 4,5-dimethyl-, hydrazone (CAS 124285-37-6) is a chemical compound characterized by its thiazolone structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound is a hydrazone derivative, indicating that it contains a hydrazone functional group (-C=N-NH2), formed through the condensation of a thiazolone with a hydrazine derivative. The presence of two methyl groups at the 4 and 5 positions of the thiazolone ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. Generally, thiazolone derivatives are known for their biological activity, which may include antimicrobial or antifungal properties. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Its specific applications and behavior in different environments would depend on further experimental studies, but it is likely to be of interest in medicinal chemistry and materials science due to its structural features.

Formula: C₅H₁₀ClN₃S

InChI: InChI=1/C5H9N3S.ClH/c1-3-4(2)9-5(7-3)8-6;/h6H2,1-2H3,(H,7,8);1H

SMILES: Cc1c(C)sc(n1)NN.Cl

Synonyms:

• (4,5-Dimethylthiazol-2-Yl)Hydrazine Hydrochloride

2-hydrazino-4,5-dimethyl-1,3-thiazole hydrochloride

CAS: 124285-37-6

Formula: C₅H₁₀ClN₃S

Molecular weight: 179.6710

Ref: IN-DA000LT5

(4,5-Dimethyl-thiazol-2-yl)-hydrazine Hydrochloride

CAS: 124285-37-6

Formula: C₅H₁₀ClN₃S

Purity: 95.0%

Molecular weight: 179.67

Ref: 10-F053524