CAS 124311-14-4
:3,4-DIBROMOPENTAFLUOROBUTYRYL CHLORIDE
Description:
3,4-Dibromopentafluorobutyryl chloride is a synthetic organic compound characterized by its unique structure, which includes both bromine and fluorine substituents. This compound features a pentafluorobutyryl moiety, indicating the presence of five fluorine atoms attached to a butyric acid derivative, along with two bromine atoms. The presence of the acyl chloride functional group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various fluorinated compounds. Its physical properties, such as boiling point and solubility, are influenced by the halogen substituents, which typically enhance the compound's polarity and reactivity. 3,4-Dibromopentafluorobutyryl chloride is often handled with caution due to its potential hazards, including toxicity and reactivity with water, which can lead to the release of hydrochloric acid. As with many halogenated compounds, it is important to consider its environmental impact and stability during storage and use.
Formula:C4Br2ClF5O
InChI:InChI=1/C4Br2ClF5O/c5-3(10,4(6,11)12)2(8,9)1(7)13
InChI key:InChIKey=UQBKGDRTYHZFME-UHFFFAOYSA-N
SMILES:C(C(C(Cl)=O)(F)F)(C(Br)(F)F)(Br)F
Synonyms:- 3,4-Dibromo-2,2,3,4,4-Pentafluorobutanoyl Chloride
- 3,4-Dibromo-2,2,3,4,4-pentafluorobutyrylchloride
- 3,4-Dibromopentafluorobutyryl Chloride, 97% Min.
- Butanoyl chloride, 3,4-dibromo-2,2,3,4,4-pentafluoro-
- 3,4-DIBROMOPENTAFLUOROBUTYRYL CHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanoyl chloride, 3,4-dibromo-2,2,3,4,4-pentafluoro-
CAS:Formula:C4Br2ClF5OMolecular weight:354.2952
