CAS 124316-00-3
:N-(triphenylphosphoranylidene)-1H-benzo-triazole-
Description:
N-(Triphenylphosphoranylidene)-1H-benzo-triazole is a chemical compound characterized by the presence of a benzo-triazole moiety linked to a triphenylphosphoranylidene group. This compound typically exhibits properties associated with both phosphonium and triazole functionalities, making it of interest in various chemical applications, including organic synthesis and coordination chemistry. The triphenylphosphoranylidene group contributes to its stability and reactivity, often acting as a strong nucleophile or a ligand in coordination complexes. The benzo-triazole part of the molecule can participate in hydrogen bonding and π-stacking interactions, which may enhance its solubility and reactivity in organic solvents. Additionally, compounds of this nature may exhibit interesting electronic properties due to the conjugation between the triazole and the phosphoranylidene, potentially leading to applications in materials science or as intermediates in the synthesis of more complex organic molecules. Overall, N-(triphenylphosphoranylidene)-1H-benzo-triazole represents a versatile structure with potential utility in various fields of chemistry.
Formula:C25H21N4P
InChI:InChI=1/C25H21N4P/c1-4-12-21(13-5-1)30(22-14-6-2-7-15-22,23-16-8-3-9-17-23)26-20-29-25-19-11-10-18-24(25)27-28-29/h1-19H,20H2
SMILES:c1ccc(cc1)P(=NCn1c2ccccc2nn1)(c1ccccc1)c1ccccc1
Synonyms:- N-(Triphenylphosphoranylidene)-1H-benzotriazole-1-methanamine
- 1-{[(triphenyl-lambda~5~-phosphanylidene)amino]methyl}-1H-benzotriazole
- benzotriazol-1-ylmethylimino(triphenyl)-$l^{5}-phosphane
- N-(triphenylphosphoranylidene)-1H-benzo-triazole-
- benzotriazol-1-ylmethylimino(triphenyl)-λsup5sup-phosphane
- 1-[[(Triphenylphosphoranylidene)amino]methyl]benzotriazole
- N-(Triphenylphosphoranylidene)-1H-benzotriazole-1-MethanaMine,90%
- N-(Triphenylphosphoranylidene)-1H-benzotriazole-1-methanamine 90%
- 1H-Benzotriazole-1-methanamine, N-(triphenylphosphoranylidene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Benzotriazole-1-methanamine, N-(triphenylphosphoranylidene)-
CAS:Formula:C25H21N4PMolecular weight:408.4348
