CAS 1243249-97-9

1-Ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-methanol

Description:

1-Ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-methanol is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyridine moiety. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, contributing to its stability and potential biological activity. The presence of an ethyl group and a hydroxymethyl group enhances its solubility and reactivity, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological properties, potentially acting as a ligand for specific receptors or enzymes. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. Additionally, the compound's CAS number, 1243249-97-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound represents a fascinating area of study for researchers interested in drug development and organic synthesis.

Formula: C₉H₁₅N₃O

InChI: InChI=1S/C9H15N3O/c1-2-12-9-3-4-10-5-7(9)8(6-13)11-12/h10,13H,2-6H2,1H3

InChI key: InChIKey=RRCPHOTWOUQSPU-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(N(CC)N1)CCNC2

Synonyms:

• 1H-Pyrazolo[4,3-c]pyridine-3-methanol, 1-ethyl-4,5,6,7-tetrahydro-
• 1-Ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-methanol