CAS 1243250-02-3

2-(4-Piperidinyloxy)benzoic acid

Description:

2-(4-Piperidinyloxy)benzoic acid, identified by its CAS number 1243250-02-3, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with a piperidinyloxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic structures, contributing to its potential biological activity. The piperidine ring, a six-membered nitrogen-containing heterocycle, imparts unique steric and electronic characteristics, which may influence the compound's solubility and reactivity. The carboxylic acid functional group in the benzoic acid portion allows for hydrogen bonding and can participate in acid-base reactions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as a ligand or modulator in biological systems. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity could be influenced by environmental factors such as pH and temperature. Overall, 2-(4-Piperidinyloxy)benzoic acid represents a versatile structure with potential applications in drug development and chemical research.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1S/C12H15NO3/c14-12(15)10-3-1-2-4-11(10)16-9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,15)

InChI key: InChIKey=RIHCGFWIHQZMEA-UHFFFAOYSA-N

SMILES: O(C1=C(C(O)=O)C=CC=C1)C2CCNCC2

Synonyms:

• Benzoic acid, 2-(4-piperidinyloxy)-
• 2-(4-Piperidinyloxy)benzoic acid

2-(4-piperidinyloxy)benzoic acid hydrochloride

CAS: 1243250-02-3

Formula: C₁₂H₁₆ClNO₃

Purity: 95%

Molecular weight: 257.71

Ref: 10-F360461