CymitQuimica logo

CAS 1243250-08-9

:

6-(1-Methylethyl)-2(1H)-pyrimidinone

Description:
6-(1-Methylethyl)-2(1H)-pyrimidinone, identified by its CAS number 1243250-08-9, is a chemical compound characterized by a pyrimidinone core structure, which consists of a six-membered ring containing nitrogen atoms. This compound features an isopropyl group (1-methylethyl) at the 6-position of the pyrimidinone ring, contributing to its unique properties. Pyrimidinones are known for their potential biological activities, including roles in pharmaceuticals and agrochemicals. The presence of the isopropyl group can influence the compound's solubility, stability, and reactivity, making it of interest in various chemical applications. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for medicinal chemistry purposes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further elucidated through spectroscopic methods. Overall, 6-(1-Methylethyl)-2(1H)-pyrimidinone represents a valuable structure for research in both synthetic and medicinal chemistry.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-5(2)6-3-4-8-7(10)9-6/h3-5H,1-2H3,(H,8,9,10)
InChI key:InChIKey=WIFRPAGGWKZFSR-UHFFFAOYSA-N
SMILES:C(C)(C)C=1NC(=O)N=CC1
Synonyms:
  • 2(1H)-Pyrimidinone, 6-(1-methylethyl)-
  • 6-(1-Methylethyl)-2(1H)-pyrimidinone
  • 4-isopropyl-2-pyrimidinol(SALTDATA: 0.87HCl 0.27H2O 0.17NH4Cl)
  • 6-Isopropylpyrimidin-2(1H)-one
  • 4-isopropylpyrimidin-2-ol hydrochloride
  • 4-isopropyl-2-pyrimidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.