CAS 1243250-09-0
:8-Amino-3,4-dihydro-6-methyl-2(1H)-quinolinone
Description:
8-Amino-3,4-dihydro-6-methyl-2(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which features a bicyclic system containing both a benzene and a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of an amino group contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The methyl group at the 6-position influences its steric and electronic properties, potentially affecting its biological activity. Compounds of this class are often investigated for their pharmacological properties, including antimicrobial and anticancer activities. Additionally, the dihydro form indicates that it may participate in further chemical transformations, such as oxidation. Overall, 8-Amino-3,4-dihydro-6-methyl-2(1H)-quinolinone represents a versatile scaffold in medicinal chemistry, with implications for drug development and synthesis.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-6-4-7-2-3-9(13)12-10(7)8(11)5-6/h4-5H,2-3,11H2,1H3,(H,12,13)
InChI key:InChIKey=UYBTVPUMRGXSHO-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C)=C1)CCC(=O)N2
Synonyms:- 2(1H)-Quinolinone, 8-amino-3,4-dihydro-6-methyl-
- 8-Amino-3,4-dihydro-6-methyl-2(1H)-quinolinone
- 8-amino-6-methyl-3,4-dihydro-2(1H)-quinolinone(SALTDATA: FREE)
- 8-amino-6-methyl-3,4-dihydroquinolin-2(1H)-one
- MFCD17078857
- 8-amino-6-methyl-3,4-dihydro-2(1H)-quinolinone
- 8-amino-6-methyl-3,4-dihydro-2(1H)-quinolinone(SALTDATA
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.