CAS 1243250-16-9
:5-Amino-α-(1-methylethyl)-1,3,4-thiadiazole-2-methanamine
Description:
5-Amino-α-(1-methylethyl)-1,3,4-thiadiazole-2-methanamine is a chemical compound characterized by its thiadiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen atoms. This compound features an amino group and a methanamine moiety, contributing to its potential reactivity and biological activity. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. Thiadiazoles are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities, making this compound of interest in medicinal chemistry. The specific arrangement of functional groups in 5-Amino-α-(1-methylethyl)-1,3,4-thiadiazole-2-methanamine may also affect its stability, reactivity, and potential applications in drug development. As with many nitrogen-containing heterocycles, this compound may exhibit tautomerism or other forms of structural isomerism, which can further influence its chemical behavior and interactions.
Formula:C6H12N4S
InChI:InChI=1S/C6H12N4S/c1-3(2)4(7)5-9-10-6(8)11-5/h3-4H,7H2,1-2H3,(H2,8,10)
InChI key:InChIKey=HXROHLJMXPFMES-UHFFFAOYSA-N
SMILES:C(C(C)C)(N)C1=NN=C(N)S1
Synonyms:- 5-Amino-α-(1-methylethyl)-1,3,4-thiadiazole-2-methanamine
- 1,3,4-Thiadiazole-2-methanamine, 5-amino-α-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.