CAS 1243250-19-2

3-Bromo-N,N,1-trimethyl-1H-1,2,4-triazol-5-amine

Description:

3-Bromo-N,N,1-trimethyl-1H-1,2,4-triazol-5-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. The presence of a bromine atom at the 3-position and three methyl groups attached to the nitrogen atoms contributes to its unique properties. This compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. The triazole moiety is known for its role in various biological applications, including antifungal and antimicrobial properties. Additionally, the compound's stability and reactivity can be influenced by the bromine substituent, which may participate in further chemical reactions. Overall, 3-Bromo-N,N,1-trimethyl-1H-1,2,4-triazol-5-amine represents a versatile structure with potential applications in various fields of chemistry and biology.

Formula: C₅H₉BrN₄

InChI: InChI=1S/C5H9BrN4/c1-9(2)5-7-4(6)8-10(5)3/h1-3H3

InChI key: InChIKey=QPGCLRNPGBADMD-UHFFFAOYSA-N

SMILES: N(C)(C)C1=NC(Br)=NN1C

Synonyms:

• 1H-1,2,4-Triazol-5-amine, 3-bromo-N,N,1-trimethyl-
• (5-Bromo-2-methyl-2H-[1,2,4]triazol-3-yl)-dimethyl-amine
• 3-Bromo-N,N,1-trimethyl-1H-1,2,4-triazol-5-amine