CymitQuimica logo

CAS 1243264-56-3

:

B-[2-(1-Methyl-1H-imidazol-2-yl)phenyl]boronic acid

Description:
B-[2-(1-Methyl-1H-imidazol-2-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 1-methyl-1H-imidazole moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under ambient conditions. The boronic acid group allows for reversible covalent bonding with diols, making it useful in various applications, including organic synthesis, medicinal chemistry, and as a ligand in coordination chemistry. Additionally, the imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals. The compound's reactivity and functional versatility make it a valuable building block in the development of complex molecules and materials. Safety data should be consulted for handling and storage, as boronic acids can be sensitive to moisture and may require specific precautions.
Formula:C10H11BN2O2
InChI:InChI=1S/C10H11BN2O2/c1-13-7-6-12-10(13)8-4-2-3-5-9(8)11(14)15/h2-7,14-15H,1H3
InChI key:InChIKey=PAEYCFAVBOWIDC-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C=CC=C1)C=2N(C)C=CN2
Synonyms:
  • Boronic acid, B-[2-(1-methyl-1H-imidazol-2-yl)phenyl]-
  • B-[2-(1-Methyl-1H-imidazol-2-yl)phenyl]boronic acid
  • [2-(1-Methyl-1H-imidazol-2-yl)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.