CAS 1243268-69-0
:N-[3-[(5-Bromo-2-chloro-4-pyrimidinyl)amino]propyl]cyclobutanecarboxamide
Description:
N-[3-[(5-Bromo-2-chloro-4-pyrimidinyl)amino]propyl]cyclobutanecarboxamide is a chemical compound characterized by its complex structure, which includes a cyclobutane ring and a pyrimidine moiety. The presence of bromine and chlorine substituents on the pyrimidine ring contributes to its unique reactivity and potential biological activity. This compound features an amine group that connects a propyl chain to the cyclobutanecarboxamide, indicating potential interactions with biological targets, making it of interest in medicinal chemistry. The molecular structure suggests it may exhibit specific pharmacological properties, possibly acting as an inhibitor or modulator in various biochemical pathways. Its CAS number, 1243268-69-0, allows for precise identification in chemical databases. As with many compounds containing halogens and heterocycles, it may exhibit significant lipophilicity, influencing its solubility and permeability in biological systems. Overall, this compound's characteristics suggest potential applications in drug development, particularly in targeting specific diseases or conditions.
Formula:C12H16BrClN4O
InChI:InChI=1S/C12H16BrClN4O/c13-9-7-17-12(14)18-10(9)15-5-2-6-16-11(19)8-3-1-4-8/h7-8H,1-6H2,(H,16,19)(H,15,17,18)
InChI key:InChIKey=UHFIANLFSZHHSH-UHFFFAOYSA-N
SMILES:N(CCCNC(=O)C1CCC1)C=2C(Br)=CN=C(Cl)N2
Synonyms:- N-[3-[(5-Bromo-2-chloro-4-pyrimidinyl)amino]propyl]cyclobutanecarboxamide
- Cyclobutanecarboxamide, N-[3-[(5-bromo-2-chloro-4-pyrimidinyl)amino]propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.