CAS 1243279-27-7

2-Chloro-6-(cyclopropyloxy)pyridine

Description:

2-Chloro-6-(cyclopropyloxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 6-position with a cyclopropyloxy group. This structure contributes to its unique chemical properties, including its potential as a building block in organic synthesis and pharmaceutical applications. The presence of the chlorine atom enhances the compound's reactivity, while the cyclopropyloxy group can influence its solubility and interaction with biological targets. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic nature of the pyridine and the aliphatic cyclopropyl group. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it valuable in synthetic chemistry. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and pharmacodynamics if explored for medicinal purposes. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₈H₈ClNO

InChI: InChI=1S/C8H8ClNO/c9-7-2-1-3-8(10-7)11-6-4-5-6/h1-3,6H,4-5H2

InChI key: InChIKey=NVYNZSXSPUNRGN-UHFFFAOYSA-N

SMILES: O(C1CC1)C=2N=C(Cl)C=CC2

Synonyms:

• 2-Chloro-6-(cyclopropyloxy)pyridine
• Pyridine, 2-chloro-6-(cyclopropyloxy)-