
CAS 1243387-63-4
:1-Bromo-3-(cyclopropyloxy)-5-nitrobenzene
Description:
1-Bromo-3-(cyclopropyloxy)-5-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a nitro group, and a cyclopropyloxy substituent. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The nitro group, known for its electron-withdrawing properties, can enhance the compound's electrophilicity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclopropyloxy group adds a unique three-membered ring structure, which can impart strain and affect the compound's overall stability and reactivity. This compound may exhibit interesting physical properties, such as solubility in organic solvents and specific melting or boiling points, depending on its molecular interactions. Additionally, its potential applications could span across fields such as pharmaceuticals, agrochemicals, or materials science, where its unique functional groups may play a crucial role in the synthesis of more complex molecules or in the development of new materials.
Formula:C9H8BrNO3
InChI:InChI=1S/C9H8BrNO3/c10-6-3-7(11(12)13)5-9(4-6)14-8-1-2-8/h3-5,8H,1-2H2
InChI key:InChIKey=LVMRLFYYIGJRMW-UHFFFAOYSA-N
SMILES:O(C1=CC(N(=O)=O)=CC(Br)=C1)C2CC2
Synonyms:- Benzene, 1-bromo-3-(cyclopropyloxy)-5-nitro-
- 1-Bromo-3-(cyclopropyloxy)-5-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.