CAS 1243391-25-4

4-Fluoro-3-hydroxybenzenesulfonamide

Description:

4-Fluoro-3-hydroxybenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group, a hydroxyl group, and a fluorine atom attached to a benzene ring. The molecular structure features a sulfonamide (-SO2NH2) group, which contributes to its potential as a pharmacological agent, particularly in medicinal chemistry. The hydroxyl group (-OH) enhances its solubility in polar solvents and may influence its reactivity and biological activity. The fluorine atom introduces unique electronic properties, potentially affecting the compound's lipophilicity and interaction with biological targets. This compound may exhibit various biological activities, making it of interest in drug development and research. Its specific applications and efficacy would depend on further studies, including its mechanism of action, pharmacokinetics, and toxicity profile. As with many sulfonamides, it may also be subject to regulatory considerations due to its potential therapeutic uses. Overall, 4-Fluoro-3-hydroxybenzenesulfonamide represents a versatile structure in organic and medicinal chemistry.

Formula: C₆H₆FNO₃S

InChI: InChI=1S/C6H6FNO3S/c7-5-2-1-4(3-6(5)9)12(8,10)11/h1-3,9H,(H2,8,10,11)

InChI key: InChIKey=WFBRPWIRVFCFHU-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(O)=C(F)C=C1

Synonyms:

• Benzenesulfonamide, 4-fluoro-3-hydroxy-
• 4-Fluoro-3-hydroxybenzenesulfonamide