CymitQuimica logo

CAS 1243391-44-7

:

Roflumilast related substance

Description:
Roflumilast related substance, identified by the CAS number 1243391-44-7, is a chemical compound associated with the pharmacological class of phosphodiesterase-4 (PDE4) inhibitors. This substance is typically characterized by its role in modulating inflammatory responses, particularly in respiratory conditions such as chronic obstructive pulmonary disease (COPD). The compound is often evaluated for its efficacy in reducing inflammation and improving lung function. Its chemical structure features specific functional groups that contribute to its biological activity, although detailed structural information is not provided here. In terms of physical properties, like many related substances, it may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many pharmaceutical compounds. Safety and toxicity profiles are also critical for this substance, as they determine its suitability for therapeutic use. Overall, Roflumilast related substance represents a significant area of research in the development of anti-inflammatory therapies.
Formula:C17H14Cl2F2N2O3
InChI:InChI=1S/C11H12O4/c12-9-4-3-8(11(13)14)5-10(9)15-6-7-1-2-7/h3-5,7,12H,1-2,6H2,(H,13,14)
InChI key:CPGNRCZMIIWDPZ-UHFFFAOYSA-N
SMILES:C1CC1COC2=C(C=CC(=C2)C(=O)O)O
Found 7 products.