CAS 124341-07-7

6-(Acetylamino)-3-bromo-2-methylbenzoic acid

Description:

6-(Acetylamino)-3-bromo-2-methylbenzoic acid, with the CAS number 124341-07-7, is an organic compound characterized by its aromatic structure, which includes a bromine atom and an acetylamino group attached to a benzoic acid framework. This compound features a carboxylic acid functional group, contributing to its acidic properties, while the presence of the acetylamino group enhances its potential for hydrogen bonding and solubility in polar solvents. The bromine substituent introduces additional reactivity, making it a useful intermediate in various chemical syntheses. The methyl group on the benzene ring influences the compound's steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. Overall, this compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would typically be determined through experimental studies and may vary based on the conditions of synthesis and purification.

Formula: C₁₀H₁₀BrNO₃

InChI: InChI=1S/C10H10BrNO3/c1-5-7(11)3-4-8(12-6(2)13)9(5)10(14)15/h3-4H,1-2H3,(H,12,13)(H,14,15)

InChI key: InChIKey=MAOQRNDUKCGKKM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(NC(C)=O)C=CC(Br)=C1C

Synonyms:

• 2-(Acetylamino)-5-bromo-6-methylbenzoic acid
• Benzoic acid, 6-(acetylamino)-3-bromo-2-methyl-
• 3-Bromo-6-acetamido-2-methylbenzoic acid
• 6-(Acetylamino)-3-bromo-2-methylbenzoic acid