CAS 124341-39-5

2,3-Diamino-6-methylbenzoic acid

Description:

2,3-Diamino-6-methylbenzoic acid is an organic compound characterized by its aromatic structure, featuring a benzoic acid core with two amino groups and a methyl substituent. The presence of the carboxylic acid group (-COOH) imparts acidic properties, while the amino groups (-NH2) contribute to its basicity and potential for forming hydrogen bonds. This compound is typically a white to off-white solid, soluble in polar solvents due to its ability to engage in hydrogen bonding. It may exhibit both acidic and basic behavior, making it a zwitterionic species in certain pH ranges. The compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential role as a building block in the synthesis of more complex molecules or as a ligand in coordination chemistry. Additionally, its structural features may influence its reactivity and interactions with biological systems, making it a subject of study in medicinal chemistry and drug design.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c1-4-2-3-5(9)7(10)6(4)8(11)12/h2-3H,9-10H2,1H3,(H,11,12)

InChI key: InChIKey=RYTXFKCONVHCQC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(N)=CC=C1C

Synonyms:

• Benzoic acid, 2,3-diamino-6-methyl-
• 2,3-Diamino-6-methylbenzoic acid