CAS 124344-98-5
:(1-METHYL-5-PHENYL-1H-PYRAZOL-3-YL)METHANOL
Description:
(1-Methyl-5-phenyl-1H-pyrazol-3-yl)methanol, with the CAS number 124344-98-5, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a phenyl group attached to the pyrazole, contributing to its unique chemical properties. The presence of the hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. Additionally, the compound may exhibit interesting reactivity patterns, including nucleophilic substitution and electrophilic aromatic substitution, owing to the functional groups present. Its stability, solubility, and reactivity make it a subject of interest for further research in various chemical and biological contexts.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-13-11(7-10(8-14)12-13)9-5-3-2-4-6-9/h2-7,14H,8H2,1H3
SMILES:Cn1c(cc(CO)n1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1-Methyl-5-phenyl-1H-pyrazol-3-yl)methanol
CAS:Controlled ProductFormula:C11H12N2OColor and Shape:NeatMolecular weight:188.226

