CymitQuimica logo

CAS 124367-33-5

:

1-(3-Nitrophenyl)cyclopropanecarboxylic acid

Description:
1-(3-Nitrophenyl)cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure fused with a carboxylic acid functional group and a nitrophenyl substituent. The presence of the nitro group on the phenyl ring contributes to its electron-withdrawing properties, which can influence the compound's reactivity and acidity. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to the carboxylic acid group. Its molecular structure allows for potential applications in pharmaceuticals and agrochemicals, particularly in the development of biologically active molecules. The compound's reactivity may be further enhanced by the presence of the nitro group, making it a candidate for various chemical transformations. Additionally, the cyclopropane ring can impart unique strain-related properties, affecting the compound's stability and interaction with other molecules. Overall, 1-(3-Nitrophenyl)cyclopropanecarboxylic acid is a versatile compound with significant potential in synthetic chemistry and medicinal applications.
Formula:C10H9NO4
InChI:InChI=1S/C10H9NO4/c12-9(13)10(4-5-10)7-2-1-3-8(6-7)11(14)15/h1-3,6H,4-5H2,(H,12,13)
InChI key:InChIKey=NWBHLEMEJAGMDV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C2=CC(N(=O)=O)=CC=C2
Synonyms:
  • 1-(3-Nitrophenyl)cyclopropane-1-carboxylic acid
  • 1-(3-Nitrophenyl)cyclopropanecarboxylic acid
  • Cyclopropanecarboxylic acid, 1-(3-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.