CAS 124388-30-3

bromo-(4-pentylphenyl)magnesium

Description:

Bromo-(4-pentylphenyl)magnesium, with the CAS number 124388-30-3, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. The presence of the bromo group indicates that it can participate in nucleophilic substitution reactions, making it useful for forming carbon-carbon bonds. The pentylphenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Grignard reagents like this one are typically used in the formation of alcohols, carboxylic acids, and other functional groups through reactions with various electrophiles. However, they are sensitive to moisture and air, requiring an anhydrous environment for stability. Overall, bromo-(4-pentylphenyl)magnesium is a valuable reagent in synthetic organic chemistry, particularly in the preparation of complex organic molecules.

Formula: C₁₁H₁₅BrMg

InChI: InChI=1/C11H15.BrH.Mg/c1-2-3-5-8-11-9-6-4-7-10-11;;/h6-7,9-10H,2-3,5,8H2,1H3;1H;/q;;+1/p-1/rC11H15BrMg/c1-2-3-4-5-10-6-8-11(13-12)9-7-10/h6-9H,2-5H2,1H3

SMILES: CCCCCC1=CC=C=C[CH]1.Br.[Mg]