CAS 124389-14-6: 4-(11-HYDROXYUNDECYLOXY)BENZALDEHYDE

Description:4-(11-Hydroxyundecyloxy)benzaldehyde is an organic compound characterized by its functional groups, which include an aldehyde and a long-chain hydroxyalkoxy substituent. The presence of the aldehyde group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The hydroxyundecyloxy chain contributes to its hydrophilicity, potentially affecting its solubility in polar solvents. This compound may exhibit interesting properties such as surfactant behavior or biological activity due to the combination of hydrophobic and hydrophilic regions. Its structure suggests potential applications in fields like materials science, pharmaceuticals, or as a chemical intermediate. Additionally, the presence of the hydroxyl group can enhance hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. Overall, 4-(11-hydroxyundecyloxy)benzaldehyde is a versatile compound with unique characteristics stemming from its molecular structure.

Formula:C₁₈H₂₈O₃

InChI:InChI=1/C18H28O3/c19-14-8-6-4-2-1-3-5-7-9-15-21-18-12-10-17(16-20)11-13-18/h10-13,16,19H,1-9,14-15H2

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzaldehyde, 4-[(11-hydroxyundecyl)oxy]- REF: IN-DA000LXWCAS: 124389-14-6	98%	50.00 €~258.00 €	Tue 15 Apr 25
4-(11-Hydroxyundecyloxy)benzaldehyde REF: 3B-H1216CAS: 124389-14-6	>98.0%(HPLC)	84.00 €~264.00 €	Mon 21 Apr 25
4-((11-Hydroxyundecyl)oxy)benzaldehyde REF: 10-F767685CAS: 124389-14-6	98%	To inquire	Fri 25 Apr 25
4-(11-Hydroxyundecyloxy)benzaldehyde REF: 3D-ZEA38914CAS: 124389-14-6	Min. 95%	- - -	Discontinued product