CAS 124389-14-6

4-(11-HYDROXYUNDECYLOXY)BENZALDEHYDE

Description:

4-(11-Hydroxyundecyloxy)benzaldehyde is an organic compound characterized by its functional groups, which include an aldehyde and a long-chain hydroxyalkoxy substituent. The presence of the aldehyde group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The hydroxyundecyloxy chain contributes to its hydrophilicity, potentially affecting its solubility in polar solvents. This compound may exhibit interesting properties such as surfactant behavior or biological activity due to the combination of hydrophobic and hydrophilic regions. Its structure suggests potential applications in fields like materials science, pharmaceuticals, or as a chemical intermediate. Additionally, the presence of the hydroxyl group can enhance hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. Overall, 4-(11-hydroxyundecyloxy)benzaldehyde is a versatile compound with unique characteristics stemming from its molecular structure.

Formula: C₁₈H₂₈O₃

InChI: InChI=1/C18H28O3/c19-14-8-6-4-2-1-3-5-7-9-15-21-18-12-10-17(16-20)11-13-18/h10-13,16,19H,1-9,14-15H2

SMILES: C(CCCCCO)CCCCCOc1ccc(cc1)C=O

Benzaldehyde, 4-[(11-hydroxyundecyl)oxy]-

CAS: 124389-14-6

Formula: C₁₈H₂₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 292.4131

Ref: IN-DA000LXW

4-(11-Hydroxyundecyloxy)benzaldehyde

CAS: 124389-14-6

Formula: C₁₈H₂₈O₃

Purity: >98.0%(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 292.42

Ref: 3B-H1216

4-((11-Hydroxyundecyl)oxy)benzaldehyde

CAS: 124389-14-6

Purity: 98.0%

Molecular weight: 292.4190063

Ref: 10-F767685