CAS 124390-37-0
:5-Methyl-12-nitrochrysene
Description:
5-Methyl-12-nitrochrysene is a polycyclic aromatic hydrocarbon (PAH) that is characterized by its complex structure, which includes multiple fused aromatic rings. This compound features a methyl group and a nitro group, which contribute to its chemical reactivity and potential biological activity. It is known for being a potent mutagen and carcinogen, often studied in the context of environmental pollution and its effects on human health. The presence of the nitro group enhances its electrophilic properties, making it capable of forming adducts with cellular macromolecules, such as DNA. 5-Methyl-12-nitrochrysene is typically found in combustion byproducts, particularly from fossil fuel burning and tobacco smoke. Its persistence in the environment raises concerns regarding its long-term ecological impact. Due to its hazardous nature, handling this compound requires strict safety protocols to minimize exposure and mitigate health risks. Research continues to explore its mechanisms of action and the implications of its presence in various environmental matrices.
Formula:C19H13NO2
InChI:InChI=1S/C19H13NO2/c1-12-10-13-6-2-3-7-14(13)17-11-18(20(21)22)15-8-4-5-9-16(15)19(12)17/h2-11H,1H3
InChI key:InChIKey=OMBRRTHRPGDGPK-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=3C(C1)=CC=CC3)C=C(N(=O)=O)C=4C2=CC=CC4
Synonyms:- 11-Methyl-6-nitrochrysene
- Chrysene, 5-methyl-12-nitro-
- 5-Methyl-12-nitrochrysene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
