CymitQuimica logo

CAS 1244019-85-9

:

Butyl 1,6-dihydro-6-oxo-4-pyrimidinecarboxylate

Description:
Butyl 1,6-dihydro-6-oxo-4-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which features a carboxylate group and a butyl ester moiety. This compound typically exhibits properties associated with both pyrimidine derivatives and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl and carboxylate functional groups. The pyrimidine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may also display specific melting and boiling points, depending on its molecular interactions and purity. Its CAS number, 1244019-85-9, allows for precise identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and organic synthesis. Overall, Butyl 1,6-dihydro-6-oxo-4-pyrimidinecarboxylate represents a unique structure that may offer diverse chemical reactivity and potential applications in drug development.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-2-3-4-14-9(13)7-5-8(12)11-6-10-7/h5-6H,2-4H2,1H3,(H,10,11,12)
InChI key:InChIKey=UWZXMCZVTXBWGH-UHFFFAOYSA-N
SMILES:C(OCCCC)(=O)C1=CC(=O)N=CN1
Synonyms:
  • 4-Pyrimidinecarboxylic acid, 1,6-dihydro-6-oxo-, butyl ester
  • Butyl 1,6-dihydro-6-oxo-4-pyrimidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.