CymitQuimica logo

CAS 124414-07-9

:

1-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]ethanone

Description:
1-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]ethanone, with CAS number 124414-07-9, is an organic compound characterized by its complex structure that includes a phenyl group, a ketone functional group, and a silyl ether moiety. This compound features a tert-butyl group attached to a dimethylsilyl group, which enhances its hydrophobic properties and stability. The presence of the ketone functional group suggests potential reactivity in various organic reactions, such as nucleophilic addition or oxidation. Its silyl ether component may also impart unique properties, such as increased resistance to hydrolysis and enhanced volatility, making it useful in various applications, including organic synthesis and materials science. The compound's molecular structure contributes to its potential utility in pharmaceuticals, agrochemicals, or as an intermediate in chemical synthesis. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the diverse functionalities that can be achieved through careful molecular design in organic chemistry.
Formula:C14H22O2Si
InChI:InChI=1S/C14H22O2Si/c1-11(15)12-8-7-9-13(10-12)16-17(5,6)14(2,3)4/h7-10H,1-6H3
InChI key:InChIKey=VPIXAJUNPDTDIJ-UHFFFAOYSA-N
SMILES:O([Si](C(C)(C)C)(C)C)C1=CC(C(C)=O)=CC=C1
Synonyms:
  • 3-(tert-Butyldimethylsiloxy)acetophenone
  • 1-[3-[(tert-Butyldimethylsilanyl)oxy]phenyl]ethanone
  • 1-[3-[(tert-Butyldimethylsilyl)oxy]phenyl]ethanone
  • 1-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]ethanone
  • Ethanone, 1-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.