CymitQuimica logo

CAS 124421-36-9

:

alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide

Description:
Alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide, identified by its CAS number 124421-36-9, is a synthetic organic compound characterized by its complex structure, which includes an acetamido group, a furan ring, and a fluorobenzyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential stability under various conditions. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and altering its biological activity. The furan ring contributes to its aromatic characteristics, which may affect its reactivity and interactions with biological targets. Such compounds are often studied for their potential pharmacological applications, including anti-inflammatory or analgesic effects, due to their structural similarities to known therapeutic agents. Overall, the unique combination of functional groups in alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide suggests a compound of interest in medicinal chemistry and drug development.
Formula:C15H15FN2O3
InChI:InChI=1/C15H15FN2O3/c1-10(19)18-14(13-3-2-8-21-13)15(20)17-9-11-4-6-12(16)7-5-11/h2-8,14H,9H2,1H3,(H,17,20)(H,18,19)
SMILES:CC(=NC(c1ccco1)C(=NCc1ccc(cc1)F)O)O
Synonyms:
  • Acnh-fbfa
  • 2-(acetylamino)-N-(4-fluorobenzyl)-2-(furan-2-yl)acetamide
  • alpha-Acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.