CAS 124424-26-6

1-(3-azido-2,3-dideoxy-2-fluoroarabinofuranosyl)thymine

Description:

1-(3-Azido-2,3-dideoxy-2-fluoroarabinofuranosyl)thymine is a nucleoside analog characterized by the presence of an azido group and a fluorine atom, which contribute to its unique chemical properties. This compound features a modified sugar moiety, specifically a dideoxy and fluorinated arabinofuranose, which alters its biological activity compared to natural nucleosides. The azido group is known for its potential in click chemistry and can facilitate various chemical reactions, making this compound of interest in medicinal chemistry and virology. The thymine base provides the nucleobase component, which is essential for its role in nucleic acid synthesis and function. Due to these modifications, this compound may exhibit antiviral properties and could be investigated for its efficacy against certain viral infections. Its structural characteristics also suggest potential applications in drug development, particularly in the design of therapeutics targeting viral replication mechanisms. Overall, this compound represents a significant area of research in the development of novel antiviral agents.

Formula: C₁₀H₁₂FN₅O₄

InChI: InChI=1/C10H12FN5O4/c1-4-2-16(10(19)13-8(4)18)9-6(11)7(14-15-12)5(3-17)20-9/h2,5-7,9,17H,3H2,1H3,(H,13,18,19)/t5-,6+,7-,9-/m1/s1

Synonyms:

• 1-(3-Azido-2,3-dideoxy-2-fluoro-beta-D-arabinofuranosyl)thymine
• 1-Adfat
• 2,4(1H,3H)-Pyrimidinedione, 1-(3-azido-2,3-dideoxy-2-fluoro-beta-D-arabinofuranosyl)-5-methyl-
• 1-(3-azido-2,3-dideoxy-2-fluoro-beta-D-arabinofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
• 1-(3-Azido-2,3-dideoxy-2-fluoroarabinofuranosyl)thymine