CAS 124425-81-6

5-{[(2-methyl-1,3-thiazol-4-yl)methyl]sulfanyl}-1,3,4-thiadiazol-2-amine

Description:

5-{[(2-methyl-1,3-thiazol-4-yl)methyl]sulfanyl}-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its complex structure, which includes a thiadiazole ring and a thiazole moiety. The presence of sulfur in both the thiadiazole and thiazole rings contributes to its unique chemical properties, such as potential reactivity and biological activity. This compound may exhibit various functional properties, including antimicrobial or antifungal activities, due to the presence of the thiazole and thiadiazole groups, which are often associated with bioactive compounds. The molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or coordination with metal ions. Additionally, the methyl group on the thiazole ring may influence its solubility and stability in different solvents. Overall, this compound's characteristics make it of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₇H₈N₄S₃

InChI: InChI=1/C7H8N4S3/c1-4-9-5(2-12-4)3-13-7-11-10-6(8)14-7/h2H,3H2,1H3,(H2,8,10)

SMILES: Cc1nc(cs1)CSc1n[nH]c(=N)s1

Synonyms:

• 1,3,4-Thiadiazol-2-Amine, 5-[[(2-Methyl-4-Thiazolyl)Methyl]Thio]-

5-([(2-Methyl-1,3-thiazol-4-yl)methyl]thio)-1,3,4-thiadiazol-2-amine

CAS: 124425-81-6

Formula: C₇H₈N₄S₃

Molecular weight: 244.3602

Ref: IN-DA000M0A

5-{[(2-methyl-1,3-thiazol-4-yl)methyl]thio}-1,3,4-thiadiazol-2-amine

CAS: 124425-81-6

Formula: C₇H₈N₄S₃

Purity: 95.0%

Molecular weight: 244.35

Ref: 10-F315967