CymitQuimica logo

CAS 124432-70-8

:

2-Methoxy-3-fluoro-5-bromopyridine

Description:
2-Methoxy-3-fluoro-5-bromopyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 2-position, a fluorine atom at the 3-position, and a bromine atom at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the methoxy group, which can influence its solubility in various organic solvents. The fluorine and bromine substituents can enhance its reactivity, making it useful in various synthetic applications, including medicinal chemistry and agrochemical development. Additionally, the presence of halogens can impart specific electronic properties, affecting the compound's behavior in chemical reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Methoxy-3-fluoro-5-bromopyridine is a valuable compound in organic synthesis and research.
Formula:C6H5BrFNO
InChI:InChI=1/C6H5BrFNO/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,1H3
InChI key:DEBFRAAJISQBIE-UHFFFAOYSA-N
SMILES:COc1c(cc(cn1)Br)F
Synonyms:
  • 5-Bromo-3-fluoro-2-methoxypyridine
  • Pyridine, 5-Bromo-3-Fluoro-2-Methoxy-
Found 5 products.