CymitQuimica logo

CAS 124436-31-3

:

1-(2-(bis-(4-fluorophenyl)methoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine

Description:
1-(2-(bis-(4-fluorophenyl)methoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine, with CAS number 124436-31-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperazine ring. This compound features multiple functional groups, including azido and iodo substituents, which can impart unique reactivity and biological activity. The presence of fluorinated phenyl groups suggests potential lipophilicity, influencing its solubility and interaction with biological membranes. The azido group may facilitate click chemistry reactions, making it useful in bioconjugation applications. Additionally, the compound's piperazine moiety is often associated with pharmacological activity, particularly in the development of pharmaceuticals targeting various receptors. Overall, this compound's intricate structure and functional diversity position it as a candidate for research in medicinal chemistry and related fields, although specific biological activities and applications would require further investigation.
Formula:C27H28F2IN5O
InChI:InChI=1/C27H28F2IN5O/c28-23-6-2-21(3-7-23)27(22-4-8-24(29)9-5-22)36-18-17-35-15-13-34(14-16-35)12-11-20-1-10-26(32-33-31)25(30)19-20/h1-10,19,27H,11-18H2
SMILES:c1cc(c(cc1CCN1CCN(CC1)CCOC(c1ccc(cc1)F)c1ccc(cc1)F)I)N=[N+]=[NH-]
Synonyms:
  • 125I-Fapp
  • 1-[2-(4-Azido-3-Iodophenyl)Ethyl]-4-{2-[Bis(4-Fluorophenyl)Methoxy]Ethyl}Piperazine
  • 1-(2-(Bis(4-fluorophenyl)methoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.