CAS 124438-61-5

N1-[3-(Trifluoromethyl)phenyl]-1,3-propanediamine

Description:

N1-[3-(Trifluoromethyl)phenyl]-1,3-propanediamine, identified by its CAS number 124438-61-5, is an organic compound characterized by its structure, which includes a trifluoromethyl group attached to a phenyl ring and a propanediamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the trifluoromethyl group enhances its lipophilicity and may impart unique electronic properties, making it of interest in medicinal chemistry and material science. It may also exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's stability, reactivity, and potential applications can be influenced by the specific arrangement of its functional groups and the overall molecular geometry. As with many amines, it may be sensitive to oxidation and can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₁₃F₃N₂

InChI: InChI=1S/C10H13F3N2/c11-10(12,13)8-3-1-4-9(7-8)15-6-2-5-14/h1,3-4,7,15H,2,5-6,14H2

InChI key: InChIKey=HUYFCKLROMLURG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(NCCCN)=CC=C1

Synonyms:

• N1-[3-(Trifluoromethyl)phenyl]-1,3-propanediamine
• 1,3-Propanediamine, N1-[3-(trifluoromethyl)phenyl]-
• 1,3-Propanediamine, N-[3-(trifluoromethyl)phenyl]-